C13H19NOS — CID 115859271
1-(3-methoxythiophen-2-yl)-N-propylpent-4-yn-1-amine (PubChem CID 115859271) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 1-(3-methoxythiophen-2-yl)-N-propylpent-4-yn-1-amine.
| Compound Name | 1-(3-methoxythiophen-2-yl)-N-propylpent-4-yn-1-amine |
|---|---|
| PubChem CID | 115859271 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-(3-methoxythiophen-2-yl)-N-propylpent-4-yn-1-amine |
| SMILES | C#CCCC(NCCC)c1sccc1OC |
| InChI | InChI=1S/C13H19NOS/c1-4-6-7-11(14-9-5-2)13-12(15-3)8-10-16-13/h1,8,10-11,14H,5-7,9H2,2-3H3 |
| InChIKey | IURFYTSUHGJCFL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|