C11H14BrNS — CID 114977322
1-(3-bromothiophen-2-yl)-N-propylbut-3-yn-1-amine (PubChem CID 114977322) has the molecular formula C11H14BrNS and a molecular weight of 272.21 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-N-propylbut-3-yn-1-amine.
| Compound Name | 1-(3-bromothiophen-2-yl)-N-propylbut-3-yn-1-amine |
|---|---|
| PubChem CID | 114977322 |
| Molecular Formula | C11H14BrNS |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-N-propylbut-3-yn-1-amine |
| SMILES | C#CCC(NCCC)c1sccc1Br |
| InChI | InChI=1S/C11H14BrNS/c1-3-5-10(13-7-4-2)11-9(12)6-8-14-11/h1,6,8,10,13H,4-5,7H2,2H3 |
| InChIKey | CYBCWXGRBQPTMI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|