C13H22BrNOS — CID 103028723
1-(3-bromothiophen-2-yl)-3-methoxy-3-methyl-N-propylbutan-1-amine (PubChem CID 103028723) has the molecular formula C13H22BrNOS and a molecular weight of 320.30 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-3-methoxy-3-methyl-N-propylbutan-1-amine.
| Compound Name | 1-(3-bromothiophen-2-yl)-3-methoxy-3-methyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 103028723 |
| Molecular Formula | C13H22BrNOS |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-3-methoxy-3-methyl-N-propylbutan-1-amine |
| SMILES | CCCNC(CC(C)(C)OC)c1sccc1Br |
| InChI | InChI=1S/C13H22BrNOS/c1-5-7-15-11(9-13(2,3)16-4)12-10(14)6-8-17-12/h6,8,11,15H,5,7,9H2,1-4H3 |
| InChIKey | MLBPNDDECBVXHI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |