C14H16Br2N2S — CID 105036190
N-[2-(5-bromo-2-pyridinyl)-1-(3-bromothiophen-2-yl)ethyl]propan-1-amine (PubChem CID 105036190) has the molecular formula C14H16Br2N2S and a molecular weight of 404.17 g/mol. Its IUPAC name is N-[2-(5-bromo-2-pyridinyl)-1-(3-bromothiophen-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(5-bromo-2-pyridinyl)-1-(3-bromothiophen-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105036190 |
| Molecular Formula | C14H16Br2N2S |
| Molecular Weight | 404.17 g/mol |
| Exact Mass | 401.94 |
| IUPAC Name | N-[2-(5-bromo-2-pyridinyl)-1-(3-bromothiophen-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(Br)cn1)c1sccc1Br |
| InChI | InChI=1S/C14H16Br2N2S/c1-2-6-17-13(14-12(16)5-7-19-14)8-11-4-3-10(15)9-18-11/h3-5,7,9,13,17H,2,6,8H2,1H3 |
| InChIKey | WDDQIYCDJIMSAB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.17 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |