C13H15Br2NS2 — CID 115847708
N-[1-(3-bromothiophen-2-yl)-2-(4-bromothiophen-2-yl)ethyl]propan-1-amine (PubChem CID 115847708) has the molecular formula C13H15Br2NS2 and a molecular weight of 409.21 g/mol. Its IUPAC name is N-[1-(3-bromothiophen-2-yl)-2-(4-bromothiophen-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(3-bromothiophen-2-yl)-2-(4-bromothiophen-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 115847708 |
| Molecular Formula | C13H15Br2NS2 |
| Molecular Weight | 409.21 g/mol |
| Exact Mass | 406.90 |
| IUPAC Name | N-[1-(3-bromothiophen-2-yl)-2-(4-bromothiophen-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cc(Br)cs1)c1sccc1Br |
| InChI | InChI=1S/C13H15Br2NS2/c1-2-4-16-12(13-11(15)3-5-17-13)7-10-6-9(14)8-18-10/h3,5-6,8,12,16H,2,4,7H2,1H3 |
| InChIKey | AMOHFVOJVOEZRV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.21 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |