C14H18BrNOS — CID 113455397
N-[2-(4-bromothiophen-2-yl)-1-(3-methylfuran-2-yl)ethyl]propan-1-amine (PubChem CID 113455397) has the molecular formula C14H18BrNOS and a molecular weight of 328.28 g/mol. Its IUPAC name is N-[2-(4-bromothiophen-2-yl)-1-(3-methylfuran-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(4-bromothiophen-2-yl)-1-(3-methylfuran-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 113455397 |
| Molecular Formula | C14H18BrNOS |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | N-[2-(4-bromothiophen-2-yl)-1-(3-methylfuran-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cc(Br)cs1)c1occc1C |
| InChI | InChI=1S/C14H18BrNOS/c1-3-5-16-13(14-10(2)4-6-17-14)8-12-7-11(15)9-18-12/h4,6-7,9,13,16H,3,5,8H2,1-2H3 |
| InChIKey | KWKHJRNKXVCVOM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |