C11H19NO — CID 104805698
1-(3-methylfuran-2-yl)-N-propylpropan-1-amine (PubChem CID 104805698) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-(3-methylfuran-2-yl)-N-propylpropan-1-amine.
| Compound Name | 1-(3-methylfuran-2-yl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 104805698 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-(3-methylfuran-2-yl)-N-propylpropan-1-amine |
| SMILES | CCCNC(CC)c1occc1C |
| InChI | InChI=1S/C11H19NO/c1-4-7-12-10(5-2)11-9(3)6-8-13-11/h6,8,10,12H,4-5,7H2,1-3H3 |
| InChIKey | XXVHNRSKFMMSLC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |