C14H19NO2S3 — CID 64629979
N-(1,2-dithiophen-2-ylethyl)-1-methylsulfonylpropan-2-amine (PubChem CID 64629979) has the molecular formula C14H19NO2S3 and a molecular weight of 329.51 g/mol. Its IUPAC name is N-(1,2-dithiophen-2-ylethyl)-1-methylsulfonylpropan-2-amine.
| Compound Name | N-(1,2-dithiophen-2-ylethyl)-1-methylsulfonylpropan-2-amine |
|---|---|
| PubChem CID | 64629979 |
| Molecular Formula | C14H19NO2S3 |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | N-(1,2-dithiophen-2-ylethyl)-1-methylsulfonylpropan-2-amine |
| SMILES | CC(CS(C)(=O)=O)NC(Cc1cccs1)c1cccs1 |
| InChI | InChI=1S/C14H19NO2S3/c1-11(10-20(2,16)17)15-13(14-6-4-8-19-14)9-12-5-3-7-18-12/h3-8,11,13,15H,9-10H2,1-2H3 |
| InChIKey | FILGHZICVQGIAQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |