C12H19NO4S2 — CID 64630549
methyl 3-(1-methylsulfonylpropan-2-ylamino)-3-thiophen-2-ylpropanoate (PubChem CID 64630549) has the molecular formula C12H19NO4S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is methyl 3-(1-methylsulfonylpropan-2-ylamino)-3-thiophen-2-ylpropanoate.
| Compound Name | methyl 3-(1-methylsulfonylpropan-2-ylamino)-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 64630549 |
| Molecular Formula | C12H19NO4S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | methyl 3-(1-methylsulfonylpropan-2-ylamino)-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)CC(NC(C)CS(C)(=O)=O)c1cccs1 |
| InChI | InChI=1S/C12H19NO4S2/c1-9(8-19(3,15)16)13-10(7-12(14)17-2)11-5-4-6-18-11/h4-6,9-10,13H,7-8H2,1-3H3 |
| InChIKey | OJWWSFIIYKIYFF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |