C14H23NO2S — CID 43724906
methyl 3-(3-methylpentan-2-ylamino)-3-thiophen-2-ylpropanoate (PubChem CID 43724906) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is methyl 3-(3-methylpentan-2-ylamino)-3-thiophen-2-ylpropanoate.
| Compound Name | methyl 3-(3-methylpentan-2-ylamino)-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 43724906 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | methyl 3-(3-methylpentan-2-ylamino)-3-thiophen-2-ylpropanoate |
| SMILES | CCC(C)C(C)NC(CC(=O)OC)c1cccs1 |
| InChI | InChI=1S/C14H23NO2S/c1-5-10(2)11(3)15-12(9-14(16)17-4)13-7-6-8-18-13/h6-8,10-12,15H,5,9H2,1-4H3 |
| InChIKey | KZILPLRTEJPDMH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |