C11H15NO2S — CID 103439049
methyl 3-(cyclopropylamino)-3-thiophen-2-ylpropanoate (PubChem CID 103439049) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is methyl 3-(cyclopropylamino)-3-thiophen-2-ylpropanoate.
| Compound Name | methyl 3-(cyclopropylamino)-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 103439049 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | methyl 3-(cyclopropylamino)-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)CC(NC1CC1)c1cccs1 |
| InChI | InChI=1S/C11H15NO2S/c1-14-11(13)7-9(12-8-4-5-8)10-3-2-6-15-10/h2-3,6,8-9,12H,4-5,7H2,1H3 |
| InChIKey | YOQOBGFNIYHTNJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |