C15H23NO4S2 — CID 95733855
methyl (3S)-3-(cyclohexylmethylsulfonylamino)-3-thiophen-2-ylpropanoate (PubChem CID 95733855) has the molecular formula C15H23NO4S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is methyl (3S)-3-(cyclohexylmethylsulfonylamino)-3-thiophen-2-ylpropanoate.
| Compound Name | methyl (3S)-3-(cyclohexylmethylsulfonylamino)-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 95733855 |
| Molecular Formula | C15H23NO4S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | methyl (3S)-3-(cyclohexylmethylsulfonylamino)-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)C[C@H](NS(=O)(=O)CC1CCCCC1)c1cccs1 |
| InChI | InChI=1S/C15H23NO4S2/c1-20-15(17)10-13(14-8-5-9-21-14)16-22(18,19)11-12-6-3-2-4-7-12/h5,8-9,12-13,16H,2-4,6-7,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | BFUVSFKGDDHGAJ-ZDUSSCGKSA-N |
| XLogP | 2.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |