C20H19NO4S2 — CID 39983352
methyl (3R)-3-[(2-phenylphenyl)sulfonylamino]-3-thiophen-2-ylpropanoate (PubChem CID 39983352) has the molecular formula C20H19NO4S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is methyl (3R)-3-[(2-phenylphenyl)sulfonylamino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl (3R)-3-[(2-phenylphenyl)sulfonylamino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 39983352 |
| Molecular Formula | C20H19NO4S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | methyl (3R)-3-[(2-phenylphenyl)sulfonylamino]-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)C[C@@H](NS(=O)(=O)c1ccccc1-c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C20H19NO4S2/c1-25-20(22)14-17(18-11-7-13-26-18)21-27(23,24)19-12-6-5-10-16(19)15-8-3-2-4-9-15/h2-13,17,21H,14H2,1H3/t17-/m1/s1 |
| InChIKey | NAUZIFLOVHJKBU-QGZVFWFLSA-N |
| XLogP | 4.00 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |