C15H19NS3 — CID 107295205
N-(thiolan-3-ylmethyl)-1,2-dithiophen-2-ylethanamine (PubChem CID 107295205) has the molecular formula C15H19NS3 and a molecular weight of 309.52 g/mol. Its IUPAC name is N-(thiolan-3-ylmethyl)-1,2-dithiophen-2-ylethanamine.
| Compound Name | N-(thiolan-3-ylmethyl)-1,2-dithiophen-2-ylethanamine |
|---|---|
| PubChem CID | 107295205 |
| Molecular Formula | C15H19NS3 |
| Molecular Weight | 309.52 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-(thiolan-3-ylmethyl)-1,2-dithiophen-2-ylethanamine |
| SMILES | c1csc(CC(NCC2CCSC2)c2cccs2)c1 |
| InChI | InChI=1S/C15H19NS3/c1-3-13(18-6-1)9-14(15-4-2-7-19-15)16-10-12-5-8-17-11-12/h1-4,6-7,12,14,16H,5,8-11H2 |
| InChIKey | BHCHIMALSHYOLR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |