C14H17NS3 — CID 103930732
N-(1,2-dithiophen-2-ylethyl)thiolan-3-amine (PubChem CID 103930732) has the molecular formula C14H17NS3 and a molecular weight of 295.50 g/mol. Its IUPAC name is N-(1,2-dithiophen-2-ylethyl)thiolan-3-amine.
| Compound Name | N-(1,2-dithiophen-2-ylethyl)thiolan-3-amine |
|---|---|
| PubChem CID | 103930732 |
| Molecular Formula | C14H17NS3 |
| Molecular Weight | 295.50 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | N-(1,2-dithiophen-2-ylethyl)thiolan-3-amine |
| SMILES | c1csc(CC(NC2CCSC2)c2cccs2)c1 |
| InChI | InChI=1S/C14H17NS3/c1-3-12(17-6-1)9-13(14-4-2-7-18-14)15-11-5-8-16-10-11/h1-4,6-7,11,13,15H,5,8-10H2 |
| InChIKey | RYMIMJLRERNSAD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |