C16H21NOS2 — CID 62087490
N-(1,2-dithiophen-2-ylethyl)-2-methoxycyclopentan-1-amine (PubChem CID 62087490) has the molecular formula C16H21NOS2 and a molecular weight of 307.48 g/mol. Its IUPAC name is N-(1,2-dithiophen-2-ylethyl)-2-methoxycyclopentan-1-amine.
| Compound Name | N-(1,2-dithiophen-2-ylethyl)-2-methoxycyclopentan-1-amine |
|---|---|
| PubChem CID | 62087490 |
| Molecular Formula | C16H21NOS2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-(1,2-dithiophen-2-ylethyl)-2-methoxycyclopentan-1-amine |
| SMILES | COC1CCCC1NC(Cc1cccs1)c1cccs1 |
| InChI | InChI=1S/C16H21NOS2/c1-18-15-7-2-6-13(15)17-14(16-8-4-10-20-16)11-12-5-3-9-19-12/h3-5,8-10,13-15,17H,2,6-7,11H2,1H3 |
| InChIKey | BPTQVUWONQNOEG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |