C17H25NS2 — CID 105136134
N-ethyl-1-(5-ethylthiophen-2-yl)-5-thiophen-2-ylpentan-2-amine (PubChem CID 105136134) has the molecular formula C17H25NS2 and a molecular weight of 307.53 g/mol. Its IUPAC name is N-ethyl-1-(5-ethylthiophen-2-yl)-5-thiophen-2-ylpentan-2-amine.
| Compound Name | N-ethyl-1-(5-ethylthiophen-2-yl)-5-thiophen-2-ylpentan-2-amine |
|---|---|
| PubChem CID | 105136134 |
| Molecular Formula | C17H25NS2 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-ethyl-1-(5-ethylthiophen-2-yl)-5-thiophen-2-ylpentan-2-amine |
| SMILES | CCNC(CCCc1cccs1)Cc1ccc(CC)s1 |
| InChI | InChI=1S/C17H25NS2/c1-3-15-10-11-17(20-15)13-14(18-4-2)7-5-8-16-9-6-12-19-16/h6,9-12,14,18H,3-5,7-8,13H2,1-2H3 |
| InChIKey | RKJTWUVQTAMRGB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |