C18H25NS — CID 63528646
N-ethyl-1-(3-methylphenyl)-5-thiophen-2-ylpentan-2-amine (PubChem CID 63528646) has the molecular formula C18H25NS and a molecular weight of 287.47 g/mol. Its IUPAC name is N-ethyl-1-(3-methylphenyl)-5-thiophen-2-ylpentan-2-amine.
| Compound Name | N-ethyl-1-(3-methylphenyl)-5-thiophen-2-ylpentan-2-amine |
|---|---|
| PubChem CID | 63528646 |
| Molecular Formula | C18H25NS |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-ethyl-1-(3-methylphenyl)-5-thiophen-2-ylpentan-2-amine |
| SMILES | CCNC(CCCc1cccs1)Cc1cccc(C)c1 |
| InChI | InChI=1S/C18H25NS/c1-3-19-17(9-5-10-18-11-6-12-20-18)14-16-8-4-7-15(2)13-16/h4,6-8,11-13,17,19H,3,5,9-10,14H2,1-2H3 |
| InChIKey | UVIXZDHKFPOXFD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |