C16H26FN — CID 61066309
1-(2-fluorophenyl)-4,4-dimethyl-N-propylpentan-2-amine (PubChem CID 61066309) has the molecular formula C16H26FN and a molecular weight of 251.39 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4,4-dimethyl-N-propylpentan-2-amine.
| Compound Name | 1-(2-fluorophenyl)-4,4-dimethyl-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 61066309 |
| Molecular Formula | C16H26FN |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 1-(2-fluorophenyl)-4,4-dimethyl-N-propylpentan-2-amine |
| SMILES | CCCNC(Cc1ccccc1F)CC(C)(C)C |
| InChI | InChI=1S/C16H26FN/c1-5-10-18-14(12-16(2,3)4)11-13-8-6-7-9-15(13)17/h6-9,14,18H,5,10-12H2,1-4H3 |
| InChIKey | RWSPTALJTKABLD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |