C15H21F4NO — CID 103475554
1-(3,5-dimethylphenyl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine (PubChem CID 103475554) has the molecular formula C15H21F4NO and a molecular weight of 307.33 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine.
| Compound Name | 1-(3,5-dimethylphenyl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine |
|---|---|
| PubChem CID | 103475554 |
| Molecular Formula | C15H21F4NO |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine |
| SMILES | CNC(COCC(F)(F)C(F)F)Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C15H21F4NO/c1-10-4-11(2)6-12(5-10)7-13(20-3)8-21-9-15(18,19)14(16)17/h4-6,13-14,20H,7-9H2,1-3H3 |
| InChIKey | FRWWAFFGQSORSB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|