C15H21F4NO — CID 103474840
1-(2,2,3,3-tetrafluoropropoxy)-3-(2,4,6-trimethylphenyl)propan-2-amine (PubChem CID 103474840) has the molecular formula C15H21F4NO and a molecular weight of 307.33 g/mol. Its IUPAC name is 1-(2,2,3,3-tetrafluoropropoxy)-3-(2,4,6-trimethylphenyl)propan-2-amine.
| Compound Name | 1-(2,2,3,3-tetrafluoropropoxy)-3-(2,4,6-trimethylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 103474840 |
| Molecular Formula | C15H21F4NO |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-(2,2,3,3-tetrafluoropropoxy)-3-(2,4,6-trimethylphenyl)propan-2-amine |
| SMILES | Cc1cc(C)c(CC(N)COCC(F)(F)C(F)F)c(C)c1 |
| InChI | InChI=1S/C15H21F4NO/c1-9-4-10(2)13(11(3)5-9)6-12(20)7-21-8-15(18,19)14(16)17/h4-5,12,14H,6-8,20H2,1-3H3 |
| InChIKey | LWCGKGRSDOKZGE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|