C13H21F4N3O — CID 103475043
1-(1,3-diethylpyrazol-5-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine (PubChem CID 103475043) has the molecular formula C13H21F4N3O and a molecular weight of 311.32 g/mol. Its IUPAC name is 1-(1,3-diethylpyrazol-5-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine.
| Compound Name | 1-(1,3-diethylpyrazol-5-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine |
|---|---|
| PubChem CID | 103475043 |
| Molecular Formula | C13H21F4N3O |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 1-(1,3-diethylpyrazol-5-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine |
| SMILES | CCc1cc(CC(N)COCC(F)(F)C(F)F)n(CC)n1 |
| InChI | InChI=1S/C13H21F4N3O/c1-3-10-6-11(20(4-2)19-10)5-9(18)7-21-8-13(16,17)12(14)15/h6,9,12H,3-5,7-8,18H2,1-2H3 |
| InChIKey | IQHVBHPENHSONH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|