C13H25N3 — CID 79411779
1-(1,3-diethylpyrazol-5-yl)hexan-2-amine (PubChem CID 79411779) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 1-(1,3-diethylpyrazol-5-yl)hexan-2-amine.
| Compound Name | 1-(1,3-diethylpyrazol-5-yl)hexan-2-amine |
|---|---|
| PubChem CID | 79411779 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 1-(1,3-diethylpyrazol-5-yl)hexan-2-amine |
| SMILES | CCCCC(N)Cc1cc(CC)nn1CC |
| InChI | InChI=1S/C13H25N3/c1-4-7-8-11(14)9-13-10-12(5-2)15-16(13)6-3/h10-11H,4-9,14H2,1-3H3 |
| InChIKey | KLNCIIDATUKHIJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |