C13H25N3 — CID 81013547
4-(1,3-diethylpyrazol-5-yl)-2,3-dimethylbutan-1-amine (PubChem CID 81013547) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 4-(1,3-diethylpyrazol-5-yl)-2,3-dimethylbutan-1-amine.
| Compound Name | 4-(1,3-diethylpyrazol-5-yl)-2,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 81013547 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 4-(1,3-diethylpyrazol-5-yl)-2,3-dimethylbutan-1-amine |
| SMILES | CCc1cc(CC(C)C(C)CN)n(CC)n1 |
| InChI | InChI=1S/C13H25N3/c1-5-12-8-13(16(6-2)15-12)7-10(3)11(4)9-14/h8,10-11H,5-7,9,14H2,1-4H3 |
| InChIKey | AWHRVNVDQMVUDO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |