C15H26N6 — CID 105318310
[2-(1,3-diethylpyrazol-5-yl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethyl]hydrazine (PubChem CID 105318310) has the molecular formula C15H26N6 and a molecular weight of 290.42 g/mol. Its IUPAC name is [2-(1,3-diethylpyrazol-5-yl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethyl]hydrazine.
| Compound Name | [2-(1,3-diethylpyrazol-5-yl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105318310 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | [2-(1,3-diethylpyrazol-5-yl)-1-(3-ethyl-1-methylpyrazol-5-yl)ethyl]hydrazine |
| SMILES | CCc1cc(C(Cc2cc(CC)nn2CC)NN)n(C)n1 |
| InChI | InChI=1S/C15H26N6/c1-5-11-8-13(21(7-3)19-11)10-14(17-16)15-9-12(6-2)18-20(15)4/h8-9,14,17H,5-7,10,16H2,1-4H3 |
| InChIKey | WDOJLPNXFSCIDD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|