C15H20F2N4 — CID 105318378
[2-(1,3-diethylpyrazol-5-yl)-1-(2,3-difluorophenyl)ethyl]hydrazine (PubChem CID 105318378) has the molecular formula C15H20F2N4 and a molecular weight of 294.35 g/mol. Its IUPAC name is [2-(1,3-diethylpyrazol-5-yl)-1-(2,3-difluorophenyl)ethyl]hydrazine.
| Compound Name | [2-(1,3-diethylpyrazol-5-yl)-1-(2,3-difluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105318378 |
| Molecular Formula | C15H20F2N4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | [2-(1,3-diethylpyrazol-5-yl)-1-(2,3-difluorophenyl)ethyl]hydrazine |
| SMILES | CCc1cc(CC(NN)c2cccc(F)c2F)n(CC)n1 |
| InChI | InChI=1S/C15H20F2N4/c1-3-10-8-11(21(4-2)20-10)9-14(19-18)12-6-5-7-13(16)15(12)17/h5-8,14,19H,3-4,9,18H2,1-2H3 |
| InChIKey | VMHBDFZZJNOVOH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|