C14H22N4O — CID 105269153
[2-(1,3-diethylpyrazol-5-yl)-1-(2-methylfuran-3-yl)ethyl]hydrazine (PubChem CID 105269153) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is [2-(1,3-diethylpyrazol-5-yl)-1-(2-methylfuran-3-yl)ethyl]hydrazine.
| Compound Name | [2-(1,3-diethylpyrazol-5-yl)-1-(2-methylfuran-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105269153 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | [2-(1,3-diethylpyrazol-5-yl)-1-(2-methylfuran-3-yl)ethyl]hydrazine |
| SMILES | CCc1cc(CC(NN)c2ccoc2C)n(CC)n1 |
| InChI | InChI=1S/C14H22N4O/c1-4-11-8-12(18(5-2)17-11)9-14(16-15)13-6-7-19-10(13)3/h6-8,14,16H,4-5,9,15H2,1-3H3 |
| InChIKey | FCUZKWJSWPLLLA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 69.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|