C14H20FN5 — CID 105258682
[2-(1,3-diethylpyrazol-5-yl)-1-(3-fluoro-4-pyridinyl)ethyl]hydrazine (PubChem CID 105258682) has the molecular formula C14H20FN5 and a molecular weight of 277.35 g/mol. Its IUPAC name is [2-(1,3-diethylpyrazol-5-yl)-1-(3-fluoro-4-pyridinyl)ethyl]hydrazine.
| Compound Name | [2-(1,3-diethylpyrazol-5-yl)-1-(3-fluoro-4-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105258682 |
| Molecular Formula | C14H20FN5 |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | [2-(1,3-diethylpyrazol-5-yl)-1-(3-fluoro-4-pyridinyl)ethyl]hydrazine |
| SMILES | CCc1cc(CC(NN)c2ccncc2F)n(CC)n1 |
| InChI | InChI=1S/C14H20FN5/c1-3-10-7-11(20(4-2)19-10)8-14(18-16)12-5-6-17-9-13(12)15/h5-7,9,14,18H,3-4,8,16H2,1-2H3 |
| InChIKey | FKTARRHAZAQIRA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|