C14H19BrFN5 — CID 105258683
[2-(4-bromo-1,3-diethylpyrazol-5-yl)-1-(3-fluoro-4-pyridinyl)ethyl]hydrazine (PubChem CID 105258683) has the molecular formula C14H19BrFN5 and a molecular weight of 356.24 g/mol. Its IUPAC name is [2-(4-bromo-1,3-diethylpyrazol-5-yl)-1-(3-fluoro-4-pyridinyl)ethyl]hydrazine.
| Compound Name | [2-(4-bromo-1,3-diethylpyrazol-5-yl)-1-(3-fluoro-4-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105258683 |
| Molecular Formula | C14H19BrFN5 |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | [2-(4-bromo-1,3-diethylpyrazol-5-yl)-1-(3-fluoro-4-pyridinyl)ethyl]hydrazine |
| SMILES | CCc1nn(CC)c(CC(NN)c2ccncc2F)c1Br |
| InChI | InChI=1S/C14H19BrFN5/c1-3-11-14(15)13(21(4-2)20-11)7-12(19-17)9-5-6-18-8-10(9)16/h5-6,8,12,19H,3-4,7,17H2,1-2H3 |
| InChIKey | QKNNUDBEZSJPFE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|