C16H23BrN4 — CID 105200822
[2-(4-bromo-1,3-diethylpyrazol-5-yl)-1-(3-methylphenyl)ethyl]hydrazine (PubChem CID 105200822) has the molecular formula C16H23BrN4 and a molecular weight of 351.29 g/mol. Its IUPAC name is [2-(4-bromo-1,3-diethylpyrazol-5-yl)-1-(3-methylphenyl)ethyl]hydrazine.
| Compound Name | [2-(4-bromo-1,3-diethylpyrazol-5-yl)-1-(3-methylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105200822 |
| Molecular Formula | C16H23BrN4 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | [2-(4-bromo-1,3-diethylpyrazol-5-yl)-1-(3-methylphenyl)ethyl]hydrazine |
| SMILES | CCc1nn(CC)c(CC(NN)c2cccc(C)c2)c1Br |
| InChI | InChI=1S/C16H23BrN4/c1-4-13-16(17)15(21(5-2)20-13)10-14(19-18)12-8-6-7-11(3)9-12/h6-9,14,19H,4-5,10,18H2,1-3H3 |
| InChIKey | JTEGRDFTVACBED-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|