C12H19N5S — CID 105316100
[1-(3-ethyl-1-methylpyrazol-5-yl)-2-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine (PubChem CID 105316100) has the molecular formula C12H19N5S and a molecular weight of 265.39 g/mol. Its IUPAC name is [1-(3-ethyl-1-methylpyrazol-5-yl)-2-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine.
| Compound Name | [1-(3-ethyl-1-methylpyrazol-5-yl)-2-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105316100 |
| Molecular Formula | C12H19N5S |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | [1-(3-ethyl-1-methylpyrazol-5-yl)-2-(2-methyl-1,3-thiazol-4-yl)ethyl]hydrazine |
| SMILES | CCc1cc(C(Cc2csc(C)n2)NN)n(C)n1 |
| InChI | InChI=1S/C12H19N5S/c1-4-9-6-12(17(3)16-9)11(15-13)5-10-7-18-8(2)14-10/h6-7,11,15H,4-5,13H2,1-3H3 |
| InChIKey | JRHCBRHWBHWKNR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|