C14H26N2O2 — CID 103449476
1-(1,3-diethylpyrazol-5-yl)-3-ethylpentane-2,3-diol (PubChem CID 103449476) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is 1-(1,3-diethylpyrazol-5-yl)-3-ethylpentane-2,3-diol.
| Compound Name | 1-(1,3-diethylpyrazol-5-yl)-3-ethylpentane-2,3-diol |
|---|---|
| PubChem CID | 103449476 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 1-(1,3-diethylpyrazol-5-yl)-3-ethylpentane-2,3-diol |
| SMILES | CCc1cc(CC(O)C(O)(CC)CC)n(CC)n1 |
| InChI | InChI=1S/C14H26N2O2/c1-5-11-9-12(16(8-4)15-11)10-13(17)14(18,6-2)7-3/h9,13,17-18H,5-8,10H2,1-4H3 |
| InChIKey | FUGWYGTZONSVDL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |