C13H22Br2N2 — CID 79455390
5-[2,2-bis(bromomethyl)butyl]-1,3-diethylpyrazole (PubChem CID 79455390) has the molecular formula C13H22Br2N2 and a molecular weight of 366.14 g/mol. Its IUPAC name is 5-[2,2-bis(bromomethyl)butyl]-1,3-diethylpyrazole.
| Compound Name | 5-[2,2-bis(bromomethyl)butyl]-1,3-diethylpyrazole |
|---|---|
| PubChem CID | 79455390 |
| Molecular Formula | C13H22Br2N2 |
| Molecular Weight | 366.14 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 5-[2,2-bis(bromomethyl)butyl]-1,3-diethylpyrazole |
| SMILES | CCc1cc(CC(CC)(CBr)CBr)n(CC)n1 |
| InChI | InChI=1S/C13H22Br2N2/c1-4-11-7-12(17(6-3)16-11)8-13(5-2,9-14)10-15/h7H,4-6,8-10H2,1-3H3 |
| InChIKey | CQAZWFXXWMUACZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.14 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|