C12H22BrN3 — CID 106844918
4-bromo-N-[(1,3-diethylpyrazol-5-yl)methyl]butan-1-amine (PubChem CID 106844918) has the molecular formula C12H22BrN3 and a molecular weight of 288.23 g/mol. Its IUPAC name is 4-bromo-N-[(1,3-diethylpyrazol-5-yl)methyl]butan-1-amine.
| Compound Name | 4-bromo-N-[(1,3-diethylpyrazol-5-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 106844918 |
| Molecular Formula | C12H22BrN3 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4-bromo-N-[(1,3-diethylpyrazol-5-yl)methyl]butan-1-amine |
| SMILES | CCc1cc(CNCCCCBr)n(CC)n1 |
| InChI | InChI=1S/C12H22BrN3/c1-3-11-9-12(16(4-2)15-11)10-14-8-6-5-7-13/h9,14H,3-8,10H2,1-2H3 |
| InChIKey | OTZKVIASLLZZGR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|