C11H20IN3 — CID 114503610
N-[(1,3-diethylpyrazol-5-yl)methyl]-3-iodopropan-1-amine (PubChem CID 114503610) has the molecular formula C11H20IN3 and a molecular weight of 321.21 g/mol. Its IUPAC name is N-[(1,3-diethylpyrazol-5-yl)methyl]-3-iodopropan-1-amine.
| Compound Name | N-[(1,3-diethylpyrazol-5-yl)methyl]-3-iodopropan-1-amine |
|---|---|
| PubChem CID | 114503610 |
| Molecular Formula | C11H20IN3 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-[(1,3-diethylpyrazol-5-yl)methyl]-3-iodopropan-1-amine |
| SMILES | CCc1cc(CNCCCI)n(CC)n1 |
| InChI | InChI=1S/C11H20IN3/c1-3-10-8-11(15(4-2)14-10)9-13-7-5-6-12/h8,13H,3-7,9H2,1-2H3 |
| InChIKey | TZWGVLFBHVIBMJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|