C12H24N4O2S — CID 106336236
N-[3-[(1,3-diethylpyrazol-5-yl)methylamino]propyl]methanesulfonamide (PubChem CID 106336236) has the molecular formula C12H24N4O2S and a molecular weight of 288.42 g/mol. Its IUPAC name is N-[3-[(1,3-diethylpyrazol-5-yl)methylamino]propyl]methanesulfonamide.
| Compound Name | N-[3-[(1,3-diethylpyrazol-5-yl)methylamino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106336236 |
| Molecular Formula | C12H24N4O2S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-[3-[(1,3-diethylpyrazol-5-yl)methylamino]propyl]methanesulfonamide |
| SMILES | CCc1cc(CNCCCNS(C)(=O)=O)n(CC)n1 |
| InChI | InChI=1S/C12H24N4O2S/c1-4-11-9-12(16(5-2)15-11)10-13-7-6-8-14-19(3,17)18/h9,13-14H,4-8,10H2,1-3H3 |
| InChIKey | RUZIAHCENAEWQU-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|