C14H16BrF2N3 — CID 107610899
4-bromo-N-[(1,3-diethylpyrazol-5-yl)methyl]-2,5-difluoroaniline (PubChem CID 107610899) has the molecular formula C14H16BrF2N3 and a molecular weight of 344.20 g/mol. Its IUPAC name is 4-bromo-N-[(1,3-diethylpyrazol-5-yl)methyl]-2,5-difluoroaniline.
| Compound Name | 4-bromo-N-[(1,3-diethylpyrazol-5-yl)methyl]-2,5-difluoroaniline |
|---|---|
| PubChem CID | 107610899 |
| Molecular Formula | C14H16BrF2N3 |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 4-bromo-N-[(1,3-diethylpyrazol-5-yl)methyl]-2,5-difluoroaniline |
| SMILES | CCc1cc(CNc2cc(F)c(Br)cc2F)n(CC)n1 |
| InChI | InChI=1S/C14H16BrF2N3/c1-3-9-5-10(20(4-2)19-9)8-18-14-7-12(16)11(15)6-13(14)17/h5-7,18H,3-4,8H2,1-2H3 |
| InChIKey | MEGZBYGQHVZGPK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|