C14H17ClIN3 — CID 107634866
4-chloro-N-[(1,3-diethylpyrazol-5-yl)methyl]-2-iodoaniline (PubChem CID 107634866) has the molecular formula C14H17ClIN3 and a molecular weight of 389.67 g/mol. Its IUPAC name is 4-chloro-N-[(1,3-diethylpyrazol-5-yl)methyl]-2-iodoaniline.
| Compound Name | 4-chloro-N-[(1,3-diethylpyrazol-5-yl)methyl]-2-iodoaniline |
|---|---|
| PubChem CID | 107634866 |
| Molecular Formula | C14H17ClIN3 |
| Molecular Weight | 389.67 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 4-chloro-N-[(1,3-diethylpyrazol-5-yl)methyl]-2-iodoaniline |
| SMILES | CCc1cc(CNc2ccc(Cl)cc2I)n(CC)n1 |
| InChI | InChI=1S/C14H17ClIN3/c1-3-11-8-12(19(4-2)18-11)9-17-14-6-5-10(15)7-13(14)16/h5-8,17H,3-4,9H2,1-2H3 |
| InChIKey | YAEVAYRGTZHZFN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.67 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|