C14H16BrF2N3S — CID 107609410
5-[(4-bromo-2,5-difluoroanilino)methyl]-N,N-diethyl-1,3-thiazol-2-amine (PubChem CID 107609410) has the molecular formula C14H16BrF2N3S and a molecular weight of 376.27 g/mol. Its IUPAC name is 5-[(4-bromo-2,5-difluoroanilino)methyl]-N,N-diethyl-1,3-thiazol-2-amine.
| Compound Name | 5-[(4-bromo-2,5-difluoroanilino)methyl]-N,N-diethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107609410 |
| Molecular Formula | C14H16BrF2N3S |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 5-[(4-bromo-2,5-difluoroanilino)methyl]-N,N-diethyl-1,3-thiazol-2-amine |
| SMILES | CCN(CC)c1ncc(CNc2cc(F)c(Br)cc2F)s1 |
| InChI | InChI=1S/C14H16BrF2N3S/c1-3-20(4-2)14-19-8-9(21-14)7-18-13-6-11(16)10(15)5-12(13)17/h5-6,8,18H,3-4,7H2,1-2H3 |
| InChIKey | VEFZQJBTJKFYSK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|