C14H19N3OS — CID 43770979
3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]phenol (PubChem CID 43770979) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]phenol.
| Compound Name | 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]phenol |
|---|---|
| PubChem CID | 43770979 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]phenol |
| SMILES | CCN(CC)c1ncc(CNc2cccc(O)c2)s1 |
| InChI | InChI=1S/C14H19N3OS/c1-3-17(4-2)14-16-10-13(19-14)9-15-11-6-5-7-12(18)8-11/h5-8,10,15,18H,3-4,9H2,1-2H3 |
| InChIKey | JDFJVCQJDNELPH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |