C13H21N3S — CID 63997522
N,N-diethyl-5-[(2-methylbut-3-yn-2-ylamino)methyl]-1,3-thiazol-2-amine (PubChem CID 63997522) has the molecular formula C13H21N3S and a molecular weight of 251.40 g/mol. Its IUPAC name is N,N-diethyl-5-[(2-methylbut-3-yn-2-ylamino)methyl]-1,3-thiazol-2-amine.
| Compound Name | N,N-diethyl-5-[(2-methylbut-3-yn-2-ylamino)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 63997522 |
| Molecular Formula | C13H21N3S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N,N-diethyl-5-[(2-methylbut-3-yn-2-ylamino)methyl]-1,3-thiazol-2-amine |
| SMILES | C#CC(C)(C)NCc1cnc(N(CC)CC)s1 |
| InChI | InChI=1S/C13H21N3S/c1-6-13(4,5)15-10-11-9-14-12(17-11)16(7-2)8-3/h1,9,15H,7-8,10H2,2-5H3 |
| InChIKey | DSTNZVHKJFMUNH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|