C12H19BrF3N3 — CID 107488604
N-(2-bromoethyl)-N-[(1,3-diethylpyrazol-5-yl)methyl]-2,2,2-trifluoroethanamine (PubChem CID 107488604) has the molecular formula C12H19BrF3N3 and a molecular weight of 342.20 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(1,3-diethylpyrazol-5-yl)methyl]-2,2,2-trifluoroethanamine.
| Compound Name | N-(2-bromoethyl)-N-[(1,3-diethylpyrazol-5-yl)methyl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 107488604 |
| Molecular Formula | C12H19BrF3N3 |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | N-(2-bromoethyl)-N-[(1,3-diethylpyrazol-5-yl)methyl]-2,2,2-trifluoroethanamine |
| SMILES | CCc1cc(CN(CCBr)CC(F)(F)F)n(CC)n1 |
| InChI | InChI=1S/C12H19BrF3N3/c1-3-10-7-11(19(4-2)17-10)8-18(6-5-13)9-12(14,15)16/h7H,3-6,8-9H2,1-2H3 |
| InChIKey | SAGXNMAUJCBXGG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|