C11H18BrF2N3 — CID 107487497
N-(2-bromoethyl)-N-[(3-ethyl-1-methylpyrazol-5-yl)methyl]-2,2-difluoroethanamine (PubChem CID 107487497) has the molecular formula C11H18BrF2N3 and a molecular weight of 310.19 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(3-ethyl-1-methylpyrazol-5-yl)methyl]-2,2-difluoroethanamine.
| Compound Name | N-(2-bromoethyl)-N-[(3-ethyl-1-methylpyrazol-5-yl)methyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 107487497 |
| Molecular Formula | C11H18BrF2N3 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-(2-bromoethyl)-N-[(3-ethyl-1-methylpyrazol-5-yl)methyl]-2,2-difluoroethanamine |
| SMILES | CCc1cc(CN(CCBr)CC(F)F)n(C)n1 |
| InChI | InChI=1S/C11H18BrF2N3/c1-3-9-6-10(16(2)15-9)7-17(5-4-12)8-11(13)14/h6,11H,3-5,7-8H2,1-2H3 |
| InChIKey | LRBYRCVJAMIOTJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|