C11H18BrF2N3 — CID 107487591
N-(2-bromoethyl)-2,2-difluoro-N-[(1-propan-2-ylpyrazol-3-yl)methyl]ethanamine (PubChem CID 107487591) has the molecular formula C11H18BrF2N3 and a molecular weight of 310.19 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,2-difluoro-N-[(1-propan-2-ylpyrazol-3-yl)methyl]ethanamine.
| Compound Name | N-(2-bromoethyl)-2,2-difluoro-N-[(1-propan-2-ylpyrazol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 107487591 |
| Molecular Formula | C11H18BrF2N3 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-(2-bromoethyl)-2,2-difluoro-N-[(1-propan-2-ylpyrazol-3-yl)methyl]ethanamine |
| SMILES | CC(C)n1ccc(CN(CCBr)CC(F)F)n1 |
| InChI | InChI=1S/C11H18BrF2N3/c1-9(2)17-5-3-10(15-17)7-16(6-4-12)8-11(13)14/h3,5,9,11H,4,6-8H2,1-2H3 |
| InChIKey | PCPQJMARGNQBBD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|