About N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine
N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine (PubChem CID 107487611) has the molecular formula C8H13BrF2N4
and a molecular weight of 283.12 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine.
Molecular Properties
| Compound Name | N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine |
| PubChem CID | 107487611 |
| Molecular Formula | C8H13BrF2N4 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine |
| SMILES | Cn1cc(CN(CCBr)CC(F)F)nn1 |
| InChI | InChI=1S/C8H13BrF2N4/c1-14-4-7(12-13-14)5-15(3-2-9)6-8(10)11/h4,8H,2-3,5-6H2,1H3 |
| InChIKey | MCXSLKJQNWTTLH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine?
The IUPAC name of N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine (CID 107487611) is N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine.
What is the SMILES notation for N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine?
The canonical SMILES for N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine is Cn1cc(CN(CCBr)CC(F)F)nn1.
What is the InChIKey of N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine?
The InChIKey is MCXSLKJQNWTTLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13BrF2N4/c1-14-4-7(12-13-14)5-15(3-2-9)6-8(10)11/h4,8H,2-3,5-6H2,1H3.
What are the key properties of N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine?
N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine has a molecular weight of 283.12 g/mol, XLogP of 1.28, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine is sourced from PubChem (CID 107487611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).