C8H13BrF2N4 — CID 107487611
N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine (PubChem CID 107487611) has the molecular formula C8H13BrF2N4 and a molecular weight of 283.12 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine.
| Compound Name | N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 107487611 |
| Molecular Formula | C8H13BrF2N4 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | N-(2-bromoethyl)-2,2-difluoro-N-[(1-methyltriazol-4-yl)methyl]ethanamine |
| SMILES | Cn1cc(CN(CCBr)CC(F)F)nn1 |
| InChI | InChI=1S/C8H13BrF2N4/c1-14-4-7(12-13-14)5-15(3-2-9)6-8(10)11/h4,8H,2-3,5-6H2,1H3 |
| InChIKey | MCXSLKJQNWTTLH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|