C10H16BrF2N3 — CID 107487595
N-(2-bromoethyl)-N-[(2,5-dimethylpyrazol-3-yl)methyl]-2,2-difluoroethanamine (PubChem CID 107487595) has the molecular formula C10H16BrF2N3 and a molecular weight of 296.16 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(2,5-dimethylpyrazol-3-yl)methyl]-2,2-difluoroethanamine.
| Compound Name | N-(2-bromoethyl)-N-[(2,5-dimethylpyrazol-3-yl)methyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 107487595 |
| Molecular Formula | C10H16BrF2N3 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | N-(2-bromoethyl)-N-[(2,5-dimethylpyrazol-3-yl)methyl]-2,2-difluoroethanamine |
| SMILES | Cc1cc(CN(CCBr)CC(F)F)n(C)n1 |
| InChI | InChI=1S/C10H16BrF2N3/c1-8-5-9(15(2)14-8)6-16(4-3-11)7-10(12)13/h5,10H,3-4,6-7H2,1-2H3 |
| InChIKey | DIURRXNCNXBCQD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|