C11H13Br2F2N — CID 107487664
N-(2-bromoethyl)-N-[(2-bromophenyl)methyl]-2,2-difluoroethanamine (PubChem CID 107487664) has the molecular formula C11H13Br2F2N and a molecular weight of 357.04 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(2-bromophenyl)methyl]-2,2-difluoroethanamine.
| Compound Name | N-(2-bromoethyl)-N-[(2-bromophenyl)methyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 107487664 |
| Molecular Formula | C11H13Br2F2N |
| Molecular Weight | 357.04 g/mol |
| Exact Mass | 354.94 |
| IUPAC Name | N-(2-bromoethyl)-N-[(2-bromophenyl)methyl]-2,2-difluoroethanamine |
| SMILES | FC(F)CN(CCBr)Cc1ccccc1Br |
| InChI | InChI=1S/C11H13Br2F2N/c12-5-6-16(8-11(14)15)7-9-3-1-2-4-10(9)13/h1-4,11H,5-8H2 |
| InChIKey | FPDGTCCHMTYGMP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.04 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|