C13H18BrF2N — CID 107487681
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-phenylpropan-1-amine (PubChem CID 107487681) has the molecular formula C13H18BrF2N and a molecular weight of 306.19 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-phenylpropan-1-amine.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 107487681 |
| Molecular Formula | C13H18BrF2N |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-phenylpropan-1-amine |
| SMILES | FC(F)CN(CCBr)CCCc1ccccc1 |
| InChI | InChI=1S/C13H18BrF2N/c14-8-10-17(11-13(15)16)9-4-7-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2 |
| InChIKey | ARNFCFXREMLUGA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|