About lithium;4-bromobutylbenzene;hydride
lithium;4-bromobutylbenzene;hydride (PubChem CID 175042628) has the molecular formula C10H14BrLi
and a molecular weight of 221.07 g/mol. Its IUPAC name is lithium;4-bromobutylbenzene;hydride.
Molecular Properties
| Compound Name | lithium;4-bromobutylbenzene;hydride |
| PubChem CID | 175042628 |
| Molecular Formula | C10H14BrLi |
| Molecular Weight | 221.07 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | lithium;4-bromobutylbenzene;hydride |
| SMILES | BrCCCCc1ccccc1.[H-].[Li+] |
| InChI | InChI=1S/C10H13Br.Li.H/c11-9-5-4-8-10-6-2-1-3-7-10;;/h1-3,6-7H,4-5,8-9H2;;/q;+1;-1 |
| InChIKey | HYBQSWQSVZFRMS-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.07 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze lithium;4-bromobutylbenzene;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;4-bromobutylbenzene;hydride?
The IUPAC name of lithium;4-bromobutylbenzene;hydride (CID 175042628) is lithium;4-bromobutylbenzene;hydride.
What is the SMILES notation for lithium;4-bromobutylbenzene;hydride?
The canonical SMILES for lithium;4-bromobutylbenzene;hydride is BrCCCCc1ccccc1.[H-].[Li+].
What is the InChIKey of lithium;4-bromobutylbenzene;hydride?
The InChIKey is HYBQSWQSVZFRMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Br.Li.H/c11-9-5-4-8-10-6-2-1-3-7-10;;/h1-3,6-7H,4-5,8-9H2;;/q;+1;-1.
What are the key properties of lithium;4-bromobutylbenzene;hydride?
lithium;4-bromobutylbenzene;hydride has a molecular weight of 221.07 g/mol, XLogP of 0.52, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;4-bromobutylbenzene;hydride is sourced from PubChem (CID 175042628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).