C10H15ClF2N2O — CID 112575301
1-chloro-3-(1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-ol (PubChem CID 112575301) has the molecular formula C10H15ClF2N2O and a molecular weight of 252.69 g/mol. Its IUPAC name is 1-chloro-3-(1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-ol.
| Compound Name | 1-chloro-3-(1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 112575301 |
| Molecular Formula | C10H15ClF2N2O |
| Molecular Weight | 252.69 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 1-chloro-3-(1,3-diethylpyrazol-5-yl)-1,1-difluoropropan-2-ol |
| SMILES | CCc1cc(CC(O)C(F)(F)Cl)n(CC)n1 |
| InChI | InChI=1S/C10H15ClF2N2O/c1-3-7-5-8(15(4-2)14-7)6-9(16)10(11,12)13/h5,9,16H,3-4,6H2,1-2H3 |
| InChIKey | XKALMZNEQXPYLX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.69 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|